C11H21NO — CID 142810512
(2Z)-2-methoxy-3-methylpenta-2,4-dien-1-amine;methylcyclopropane (PubChem CID 142810512) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (2Z)-2-methoxy-3-methylpenta-2,4-dien-1-amine;methylcyclopropane.
| Compound Name | (2Z)-2-methoxy-3-methylpenta-2,4-dien-1-amine;methylcyclopropane |
|---|---|
| PubChem CID | 142810512 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (2Z)-2-methoxy-3-methylpenta-2,4-dien-1-amine;methylcyclopropane |
| SMILES | C=C/C(C)=C(/CN)OC.CC1CC1 |
| InChI | InChI=1S/C7H13NO.C4H8/c1-4-6(2)7(5-8)9-3;1-4-2-3-4/h4H,1,5,8H2,2-3H3;4H,2-3H2,1H3/b7-6-; |
| InChIKey | PTNATKWIUBMZSL-NAFXZHHSSA-N |
| XLogP | 2.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|