C10H16O — CID 123543199
3-ethenyl-2-ethoxyhexa-1,3-diene (PubChem CID 123543199) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-ethenyl-2-ethoxyhexa-1,3-diene.
| Compound Name | 3-ethenyl-2-ethoxyhexa-1,3-diene |
|---|---|
| PubChem CID | 123543199 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 3-ethenyl-2-ethoxyhexa-1,3-diene |
| SMILES | C=CC(=CCC)C(=C)OCC |
| InChI | InChI=1S/C10H16O/c1-5-8-10(6-2)9(4)11-7-3/h6,8H,2,4-5,7H2,1,3H3 |
| InChIKey | BBCIJUVPTOWLEQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|