C7H7F3OS — CID 142042475
(3Z)-5-(trifluoromethoxy)hexa-1,3,5-triene-2-thiol (PubChem CID 142042475) has the molecular formula C7H7F3OS and a molecular weight of 196.19 g/mol. Its IUPAC name is (3Z)-5-(trifluoromethoxy)hexa-1,3,5-triene-2-thiol.
| Compound Name | (3Z)-5-(trifluoromethoxy)hexa-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 142042475 |
| Molecular Formula | C7H7F3OS |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | (3Z)-5-(trifluoromethoxy)hexa-1,3,5-triene-2-thiol |
| SMILES | C=C(S)/C=C\C(=C)OC(F)(F)F |
| InChI | InChI=1S/C7H7F3OS/c1-5(3-4-6(2)12)11-7(8,9)10/h3-4,12H,1-2H2/b4-3- |
| InChIKey | IOXGWQWOBDSRTD-ARJAWSKDSA-N |
| XLogP | 3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|