C8H7F3O3 — CID 144580682
(3Z)-2-methylidene-5-(trifluoromethoxy)hexa-3,5-dienoic acid (PubChem CID 144580682) has the molecular formula C8H7F3O3 and a molecular weight of 208.13 g/mol. Its IUPAC name is (3Z)-2-methylidene-5-(trifluoromethoxy)hexa-3,5-dienoic acid.
| Compound Name | (3Z)-2-methylidene-5-(trifluoromethoxy)hexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 144580682 |
| Molecular Formula | C8H7F3O3 |
| Molecular Weight | 208.13 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | (3Z)-2-methylidene-5-(trifluoromethoxy)hexa-3,5-dienoic acid |
| SMILES | C=C(/C=C\C(=C)C(=O)O)OC(F)(F)F |
| InChI | InChI=1S/C8H7F3O3/c1-5(7(12)13)3-4-6(2)14-8(9,10)11/h3-4H,1-2H2,(H,12,13)/b4-3- |
| InChIKey | WJLKADBTEZDIFB-ARJAWSKDSA-N |
| XLogP | 2.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.13 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|