C13H14O3 — CID 145356747
(3Z,8Z)-2,10-dihydroxy-5,7-dimethylideneundeca-1,3,8,10-tetraen-6-one (PubChem CID 145356747) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (3Z,8Z)-2,10-dihydroxy-5,7-dimethylideneundeca-1,3,8,10-tetraen-6-one.
| Compound Name | (3Z,8Z)-2,10-dihydroxy-5,7-dimethylideneundeca-1,3,8,10-tetraen-6-one |
|---|---|
| PubChem CID | 145356747 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (3Z,8Z)-2,10-dihydroxy-5,7-dimethylideneundeca-1,3,8,10-tetraen-6-one |
| SMILES | C=C(O)/C=C\C(=C)C(=O)C(=C)/C=C\C(=C)O |
| InChI | InChI=1S/C13H14O3/c1-9(5-7-11(3)14)13(16)10(2)6-8-12(4)15/h5-8,14-15H,1-4H2/b7-5-,8-6- |
| InChIKey | UJZZINZLLHUGAD-SFECMWDFSA-N |
| XLogP | 2.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|