C6H8O2S2 — CID 144756555
(3Z)-2,5-bis(sulfanyloxy)hexa-1,3,5-triene (PubChem CID 144756555) has the molecular formula C6H8O2S2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (3Z)-2,5-bis(sulfanyloxy)hexa-1,3,5-triene.
| Compound Name | (3Z)-2,5-bis(sulfanyloxy)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 144756555 |
| Molecular Formula | C6H8O2S2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | (3Z)-2,5-bis(sulfanyloxy)hexa-1,3,5-triene |
| SMILES | C=C(/C=C\C(=C)OS)OS |
| InChI | InChI=1S/C6H8O2S2/c1-5(7-9)3-4-6(2)8-10/h3-4,9-10H,1-2H2/b4-3- |
| InChIKey | XGDMWRMAGHKFEF-ARJAWSKDSA-N |
| XLogP | 2.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|