C11H14O — CID 123593595
6-methyl-2-prop-2-ynoxyhepta-1,3,5-triene (PubChem CID 123593595) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 6-methyl-2-prop-2-ynoxyhepta-1,3,5-triene.
| Compound Name | 6-methyl-2-prop-2-ynoxyhepta-1,3,5-triene |
|---|---|
| PubChem CID | 123593595 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 6-methyl-2-prop-2-ynoxyhepta-1,3,5-triene |
| SMILES | C#CCOC(=C)C=CC=C(C)C |
| InChI | InChI=1S/C11H14O/c1-5-9-12-11(4)8-6-7-10(2)3/h1,6-8H,4,9H2,2-3H3 |
| InChIKey | SQPAYMLLSMQUJH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|