C13H21N — CID 143998007
(4Z)-7-methyl-3-methylidene-N-prop-1-en-2-ylocta-4,6-dien-1-amine (PubChem CID 143998007) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (4Z)-7-methyl-3-methylidene-N-prop-1-en-2-ylocta-4,6-dien-1-amine.
| Compound Name | (4Z)-7-methyl-3-methylidene-N-prop-1-en-2-ylocta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 143998007 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (4Z)-7-methyl-3-methylidene-N-prop-1-en-2-ylocta-4,6-dien-1-amine |
| SMILES | C=C(/C=C\C=C(C)C)CCNC(=C)C |
| InChI | InChI=1S/C13H21N/c1-11(2)7-6-8-13(5)9-10-14-12(3)4/h6-8,14H,3,5,9-10H2,1-2,4H3/b8-6- |
| InChIKey | YNDJBQVEUVMYSG-VURMDHGXSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|