C15H32N4 — CID 58965145
N,N'-bis[3-(prop-1-en-2-ylamino)propyl]propane-1,3-diamine (PubChem CID 58965145) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is N,N'-bis[3-(prop-1-en-2-ylamino)propyl]propane-1,3-diamine.
| Compound Name | N,N'-bis[3-(prop-1-en-2-ylamino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 58965145 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | N,N'-bis[3-(prop-1-en-2-ylamino)propyl]propane-1,3-diamine |
| SMILES | C=C(C)NCCCNCCCNCCCNC(=C)C |
| InChI | InChI=1S/C15H32N4/c1-14(2)18-12-6-10-16-8-5-9-17-11-7-13-19-15(3)4/h16-19H,1,3,5-13H2,2,4H3 |
| InChIKey | NPDWTCXVXMCWDR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|