C12H23N5O4 — CID 6411323
(2Z)-2-hydroxyimino-N-[3-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propylamino]propyl]propanamide (PubChem CID 6411323) has the molecular formula C12H23N5O4 and a molecular weight of 301.35 g/mol. Its IUPAC name is (2Z)-2-hydroxyimino-N-[3-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propylamino]propyl]propanamide.
| Compound Name | (2Z)-2-hydroxyimino-N-[3-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propylamino]propyl]propanamide |
|---|---|
| PubChem CID | 6411323 |
| Molecular Formula | C12H23N5O4 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (2Z)-2-hydroxyimino-N-[3-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propylamino]propyl]propanamide |
| SMILES | C/C(=N/O)C(=O)NCCCNCCCNC(=O)/C(C)=N\O |
| InChI | InChI=1S/C12H23N5O4/c1-9(16-20)11(18)14-7-3-5-13-6-4-8-15-12(19)10(2)17-21/h13,20-21H,3-8H2,1-2H3,(H,14,18)(H,15,19)/b16-9-,17-10- |
| InChIKey | YTLCBOMPDFFOGW-CQRYCMKKSA-N |
| XLogP | -0.71 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|