C22H27N5O4 — CID 6801703
2-hydroxyimino-N-[3-[3-[(2-hydroxyimino-2-phenylacetyl)amino]propylamino]propyl]-2-phenylacetamide (PubChem CID 6801703) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-hydroxyimino-N-[3-[3-[(2-hydroxyimino-2-phenylacetyl)amino]propylamino]propyl]-2-phenylacetamide.
| Compound Name | 2-hydroxyimino-N-[3-[3-[(2-hydroxyimino-2-phenylacetyl)amino]propylamino]propyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 6801703 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-hydroxyimino-N-[3-[3-[(2-hydroxyimino-2-phenylacetyl)amino]propylamino]propyl]-2-phenylacetamide |
| SMILES | O=C(NCCCNCCCNC(=O)C(=NO)c1ccccc1)C(=NO)c1ccccc1 |
| InChI | InChI=1S/C22H27N5O4/c28-21(19(26-30)17-9-3-1-4-10-17)24-15-7-13-23-14-8-16-25-22(29)20(27-31)18-11-5-2-6-12-18/h1-6,9-12,23,30-31H,7-8,13-16H2,(H,24,28)(H,25,29) |
| InChIKey | KHQOKRKRRYMRMU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|