C16H24N3O2+ — CID 7322149
(2E)-2-hydroxyimino-2-phenyl-N-(3-piperidin-1-ium-1-ylpropyl)acetamide (PubChem CID 7322149) has the molecular formula C16H24N3O2+ and a molecular weight of 290.39 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-2-phenyl-N-(3-piperidin-1-ium-1-ylpropyl)acetamide.
| Compound Name | (2E)-2-hydroxyimino-2-phenyl-N-(3-piperidin-1-ium-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 7322149 |
| Molecular Formula | C16H24N3O2+ |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (2E)-2-hydroxyimino-2-phenyl-N-(3-piperidin-1-ium-1-ylpropyl)acetamide |
| SMILES | O=C(NCCC[NH+]1CCCCC1)/C(=N/O)c1ccccc1 |
| InChI | InChI=1S/C16H23N3O2/c20-16(15(18-21)14-8-3-1-4-9-14)17-10-7-13-19-11-5-2-6-12-19/h1,3-4,8-9,21H,2,5-7,10-13H2,(H,17,20)/p+1/b18-15+ |
| InChIKey | DNXMAODAKMEZAW-OBGWFSINSA-O |
| XLogP | 0.44 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|