C20H25N2O+ — CID 7346826
4-phenyl-N-(2-piperidin-1-ium-1-ylethyl)benzamide (PubChem CID 7346826) has the molecular formula C20H25N2O+ and a molecular weight of 309.43 g/mol. Its IUPAC name is 4-phenyl-N-(2-piperidin-1-ium-1-ylethyl)benzamide.
| Compound Name | 4-phenyl-N-(2-piperidin-1-ium-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 7346826 |
| Molecular Formula | C20H25N2O+ |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 4-phenyl-N-(2-piperidin-1-ium-1-ylethyl)benzamide |
| SMILES | O=C(NCC[NH+]1CCCCC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O/c23-20(21-13-16-22-14-5-2-6-15-22)19-11-9-18(10-12-19)17-7-3-1-4-8-17/h1,3-4,7-12H,2,5-6,13-16H2,(H,21,23)/p+1 |
| InChIKey | XMVFAHQBMBZBQI-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |