C21H30N3O2+ — CID 5015970
N-[3-(azepan-1-ium-1-yl)propyl]-2-(3-methyl-1-oxoisoquinolin-2-yl)acetamide (PubChem CID 5015970) has the molecular formula C21H30N3O2+ and a molecular weight of 356.49 g/mol. Its IUPAC name is N-[3-(azepan-1-ium-1-yl)propyl]-2-(3-methyl-1-oxoisoquinolin-2-yl)acetamide.
| Compound Name | N-[3-(azepan-1-ium-1-yl)propyl]-2-(3-methyl-1-oxoisoquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 5015970 |
| Molecular Formula | C21H30N3O2+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-[3-(azepan-1-ium-1-yl)propyl]-2-(3-methyl-1-oxoisoquinolin-2-yl)acetamide |
| SMILES | Cc1cc2ccccc2c(=O)n1CC(=O)NCCC[NH+]1CCCCCC1 |
| InChI | InChI=1S/C21H29N3O2/c1-17-15-18-9-4-5-10-19(18)21(26)24(17)16-20(25)22-11-8-14-23-12-6-2-3-7-13-23/h4-5,9-10,15H,2-3,6-8,11-14,16H2,1H3,(H,22,25)/p+1 |
| InChIKey | ZSOKZXAQPCNSNK-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 55.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|