C13H19N4O3+ — CID 8991051
N-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propyl]-1-methylpyridin-1-ium-4-carboxamide (PubChem CID 8991051) has the molecular formula C13H19N4O3+ and a molecular weight of 279.32 g/mol. Its IUPAC name is N-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propyl]-1-methylpyridin-1-ium-4-carboxamide.
| Compound Name | N-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propyl]-1-methylpyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8991051 |
| Molecular Formula | C13H19N4O3+ |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propyl]-1-methylpyridin-1-ium-4-carboxamide |
| SMILES | C/C(=N/O)C(=O)NCCCNC(=O)c1cc[n+](C)cc1 |
| InChI | InChI=1S/C13H18N4O3/c1-10(16-20)12(18)14-6-3-7-15-13(19)11-4-8-17(2)9-5-11/h4-5,8-9H,3,6-7H2,1-2H3,(H2-,14,15,18,19,20)/p+1 |
| InChIKey | IKGFTUJIKJGVPP-UHFFFAOYSA-O |
| XLogP | -0.40 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|