C12H18N5O3+ — CID 8991053
N-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propyl]-4-methylpyrazin-4-ium-2-carboxamide (PubChem CID 8991053) has the molecular formula C12H18N5O3+ and a molecular weight of 280.31 g/mol. Its IUPAC name is N-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propyl]-4-methylpyrazin-4-ium-2-carboxamide.
| Compound Name | N-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propyl]-4-methylpyrazin-4-ium-2-carboxamide |
|---|---|
| PubChem CID | 8991053 |
| Molecular Formula | C12H18N5O3+ |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-[3-[[(2Z)-2-hydroxyiminopropanoyl]amino]propyl]-4-methylpyrazin-4-ium-2-carboxamide |
| SMILES | C/C(=N/O)C(=O)NCCCNC(=O)c1c[n+](C)ccn1 |
| InChI | InChI=1S/C12H17N5O3/c1-9(16-20)11(18)14-4-3-5-15-12(19)10-8-17(2)7-6-13-10/h6-8H,3-5H2,1-2H3,(H2-,14,15,18,19,20)/p+1 |
| InChIKey | CCMWDVITLXKURX-UHFFFAOYSA-O |
| XLogP | -1.01 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|