C15H27N5O — CID 109207266
4-[2-(dimethylamino)ethylamino]-N-[3-(dimethylamino)propyl]pyridine-2-carboxamide (PubChem CID 109207266) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethylamino]-N-[3-(dimethylamino)propyl]pyridine-2-carboxamide.
| Compound Name | 4-[2-(dimethylamino)ethylamino]-N-[3-(dimethylamino)propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109207266 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 4-[2-(dimethylamino)ethylamino]-N-[3-(dimethylamino)propyl]pyridine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc(NCCN(C)C)ccn1 |
| InChI | InChI=1S/C15H27N5O/c1-19(2)10-5-7-18-15(21)14-12-13(6-8-17-14)16-9-11-20(3)4/h6,8,12H,5,7,9-11H2,1-4H3,(H,16,17)(H,18,21) |
| InChIKey | KMJSBGMXKQXJOP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|