C16H19ClN4O — CID 109207365
N-(4-chlorophenyl)-4-[2-(dimethylamino)ethylamino]pyridine-2-carboxamide (PubChem CID 109207365) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[2-(dimethylamino)ethylamino]pyridine-2-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[2-(dimethylamino)ethylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109207365 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(4-chlorophenyl)-4-[2-(dimethylamino)ethylamino]pyridine-2-carboxamide |
| SMILES | CN(C)CCNc1ccnc(C(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H19ClN4O/c1-21(2)10-9-18-14-7-8-19-15(11-14)16(22)20-13-5-3-12(17)4-6-13/h3-8,11H,9-10H2,1-2H3,(H,18,19)(H,20,22) |
| InChIKey | DPYLGCBPPXPZKE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |