C18H22N4O3 — CID 109207394
methyl 2-[[4-[2-(dimethylamino)ethylamino]pyridine-2-carbonyl]amino]benzoate (PubChem CID 109207394) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is methyl 2-[[4-[2-(dimethylamino)ethylamino]pyridine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[4-[2-(dimethylamino)ethylamino]pyridine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109207394 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | methyl 2-[[4-[2-(dimethylamino)ethylamino]pyridine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cc(NCCN(C)C)ccn1 |
| InChI | InChI=1S/C18H22N4O3/c1-22(2)11-10-19-13-8-9-20-16(12-13)17(23)21-15-7-5-4-6-14(15)18(24)25-3/h4-9,12H,10-11H2,1-3H3,(H,19,20)(H,21,23) |
| InChIKey | KHCGHSSNNYMPTH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |