C10H14N5O3+ — CID 8991039
N-[2-[[(2Z)-2-hydroxyiminoacetyl]amino]ethyl]-4-methylpyrazin-4-ium-2-carboxamide (PubChem CID 8991039) has the molecular formula C10H14N5O3+ and a molecular weight of 252.25 g/mol. Its IUPAC name is N-[2-[[(2Z)-2-hydroxyiminoacetyl]amino]ethyl]-4-methylpyrazin-4-ium-2-carboxamide.
| Compound Name | N-[2-[[(2Z)-2-hydroxyiminoacetyl]amino]ethyl]-4-methylpyrazin-4-ium-2-carboxamide |
|---|---|
| PubChem CID | 8991039 |
| Molecular Formula | C10H14N5O3+ |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[2-[[(2Z)-2-hydroxyiminoacetyl]amino]ethyl]-4-methylpyrazin-4-ium-2-carboxamide |
| SMILES | C[n+]1ccnc(C(=O)NCCNC(=O)/C=N\O)c1 |
| InChI | InChI=1S/C10H13N5O3/c1-15-5-4-11-8(7-15)10(17)13-3-2-12-9(16)6-14-18/h4-7H,2-3H2,1H3,(H2-,12,13,16,17,18)/p+1 |
| InChIKey | HKJDHPAANKYZET-UHFFFAOYSA-O |
| XLogP | -1.79 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|