C16H19N6O3+ — CID 8991071
4-methyl-N-[2-[[1-methyl-6-(nitrosomethylidene)pyridine-3-carbonyl]amino]ethyl]pyrazin-4-ium-2-carboxamide (PubChem CID 8991071) has the molecular formula C16H19N6O3+ and a molecular weight of 343.37 g/mol. Its IUPAC name is 4-methyl-N-[2-[[1-methyl-6-(nitrosomethylidene)pyridine-3-carbonyl]amino]ethyl]pyrazin-4-ium-2-carboxamide.
| Compound Name | 4-methyl-N-[2-[[1-methyl-6-(nitrosomethylidene)pyridine-3-carbonyl]amino]ethyl]pyrazin-4-ium-2-carboxamide |
|---|---|
| PubChem CID | 8991071 |
| Molecular Formula | C16H19N6O3+ |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-methyl-N-[2-[[1-methyl-6-(nitrosomethylidene)pyridine-3-carbonyl]amino]ethyl]pyrazin-4-ium-2-carboxamide |
| SMILES | CN1C=C(C(=O)NCCNC(=O)c2c[n+](C)ccn2)C=CC1=CN=O |
| InChI | InChI=1S/C16H18N6O3/c1-21-8-7-17-14(11-21)16(24)19-6-5-18-15(23)12-3-4-13(9-20-25)22(2)10-12/h3-4,7-11H,5-6H2,1-2H3,(H-,18,19,23,24)/p+1 |
| InChIKey | FRCRKFNVVXWEKP-UHFFFAOYSA-O |
| XLogP | -0.25 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|