C18H19FN4O4S — CID 30755038
N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 30755038) has the molecular formula C18H19FN4O4S and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 30755038 |
| Molecular Formula | C18H19FN4O4S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)cc1F |
| InChI | InChI=1S/C18H19FN4O4S/c1-12-2-3-13(10-15(12)19)17(24)20-6-7-21-18(25)14-4-5-16-22-28(26,27)9-8-23(16)11-14/h2-5,10-11H,6-9H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | DZTWPAGWMXBJIO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|