C10H18N4O2 — CID 107973596
N-[2-(2-hydroxypropylamino)ethyl]-1-methylimidazole-4-carboxamide (PubChem CID 107973596) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]-1-methylimidazole-4-carboxamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 107973596 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]-1-methylimidazole-4-carboxamide |
| SMILES | CC(O)CNCCNC(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C10H18N4O2/c1-8(15)5-11-3-4-12-10(16)9-6-14(2)7-13-9/h6-8,11,15H,3-5H2,1-2H3,(H,12,16) |
| InChIKey | BBFQKSPBYHSCMG-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|