C9H18N4O3S — CID 104594021
N-[2-(2-hydroxypropylamino)ethyl]-1-methylimidazole-4-sulfonamide (PubChem CID 104594021) has the molecular formula C9H18N4O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 104594021 |
| Molecular Formula | C9H18N4O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]-1-methylimidazole-4-sulfonamide |
| SMILES | CC(O)CNCCNS(=O)(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C9H18N4O3S/c1-8(14)5-10-3-4-12-17(15,16)9-6-13(2)7-11-9/h6-8,10,12,14H,3-5H2,1-2H3 |
| InChIKey | MRBWJAQPAPAVEK-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|