C7H11N3O4S — CID 62374275
3-[(1-methylimidazol-4-yl)sulfonylamino]propanoic acid (PubChem CID 62374275) has the molecular formula C7H11N3O4S and a molecular weight of 233.25 g/mol. Its IUPAC name is 3-[(1-methylimidazol-4-yl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(1-methylimidazol-4-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 62374275 |
| Molecular Formula | C7H11N3O4S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 3-[(1-methylimidazol-4-yl)sulfonylamino]propanoic acid |
| SMILES | Cn1cnc(S(=O)(=O)NCCC(=O)O)c1 |
| InChI | InChI=1S/C7H11N3O4S/c1-10-4-6(8-5-10)15(13,14)9-3-2-7(11)12/h4-5,9H,2-3H2,1H3,(H,11,12) |
| InChIKey | XCNFUNUISXHLBE-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |