C11H19N3O3 — CID 107972296
N-(2,2-diethoxyethyl)-1-methylimidazole-4-carboxamide (PubChem CID 107972296) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-1-methylimidazole-4-carboxamide.
| Compound Name | N-(2,2-diethoxyethyl)-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 107972296 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-(2,2-diethoxyethyl)-1-methylimidazole-4-carboxamide |
| SMILES | CCOC(CNC(=O)c1cn(C)cn1)OCC |
| InChI | InChI=1S/C11H19N3O3/c1-4-16-10(17-5-2)6-12-11(15)9-7-14(3)8-13-9/h7-8,10H,4-6H2,1-3H3,(H,12,15) |
| InChIKey | JFTFVHWTTZDSTG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|