C11H17N3O3 — CID 103602082
N-(2,2-diethoxyethyl)pyrazine-2-carboxamide (PubChem CID 103602082) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)pyrazine-2-carboxamide.
| Compound Name | N-(2,2-diethoxyethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 103602082 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-(2,2-diethoxyethyl)pyrazine-2-carboxamide |
| SMILES | CCOC(CNC(=O)c1cnccn1)OCC |
| InChI | InChI=1S/C11H17N3O3/c1-3-16-10(17-4-2)8-14-11(15)9-7-12-5-6-13-9/h5-7,10H,3-4,8H2,1-2H3,(H,14,15) |
| InChIKey | AVKDZIBORDXTBY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|