C11H17N3O3 — CID 113430399
3-hydroxy-N-[2-(2-hydroxypropylamino)ethyl]pyridine-2-carboxamide (PubChem CID 113430399) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-hydroxy-N-[2-(2-hydroxypropylamino)ethyl]pyridine-2-carboxamide.
| Compound Name | 3-hydroxy-N-[2-(2-hydroxypropylamino)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 113430399 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-hydroxy-N-[2-(2-hydroxypropylamino)ethyl]pyridine-2-carboxamide |
| SMILES | CC(O)CNCCNC(=O)c1ncccc1O |
| InChI | InChI=1S/C11H17N3O3/c1-8(15)7-12-5-6-14-11(17)10-9(16)3-2-4-13-10/h2-4,8,12,15-16H,5-7H2,1H3,(H,14,17) |
| InChIKey | TVWDDWREQZSSHU-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|