C9H11BrN2O2 — CID 107519736
3-bromo-N-[(2S)-2-hydroxypropyl]pyridine-2-carboxamide (PubChem CID 107519736) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is 3-bromo-N-[(2S)-2-hydroxypropyl]pyridine-2-carboxamide.
| Compound Name | 3-bromo-N-[(2S)-2-hydroxypropyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107519736 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 3-bromo-N-[(2S)-2-hydroxypropyl]pyridine-2-carboxamide |
| SMILES | C[C@H](O)CNC(=O)c1ncccc1Br |
| InChI | InChI=1S/C9H11BrN2O2/c1-6(13)5-12-9(14)8-7(10)3-2-4-11-8/h2-4,6,13H,5H2,1H3,(H,12,14)/t6-/m0/s1 |
| InChIKey | KGRUVZSZVWCVGS-LURJTMIESA-N |
| XLogP | 0.95 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |