C13H19BrN2O2 — CID 114078844
3-bromo-N-[2-(2-hydroxyethyl)pentyl]pyridine-2-carboxamide (PubChem CID 114078844) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 3-bromo-N-[2-(2-hydroxyethyl)pentyl]pyridine-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(2-hydroxyethyl)pentyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114078844 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 3-bromo-N-[2-(2-hydroxyethyl)pentyl]pyridine-2-carboxamide |
| SMILES | CCCC(CCO)CNC(=O)c1ncccc1Br |
| InChI | InChI=1S/C13H19BrN2O2/c1-2-4-10(6-8-17)9-16-13(18)12-11(14)5-3-7-15-12/h3,5,7,10,17H,2,4,6,8-9H2,1H3,(H,16,18) |
| InChIKey | LICUMKDZZSCJNE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |