C16H18N4O4S — CID 108540814
N-[2-[[4-(methanesulfonamido)benzoyl]amino]ethyl]pyridine-2-carboxamide (PubChem CID 108540814) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[2-[[4-(methanesulfonamido)benzoyl]amino]ethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-[[4-(methanesulfonamido)benzoyl]amino]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 108540814 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[2-[[4-(methanesulfonamido)benzoyl]amino]ethyl]pyridine-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)NCCNC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C16H18N4O4S/c1-25(23,24)20-13-7-5-12(6-8-13)15(21)18-10-11-19-16(22)14-4-2-3-9-17-14/h2-9,20H,10-11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | JHPBKEDZCIONIK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|