C10H13Cl2N4O2+ — CID 8991081
N-[2-[(2,2-dichloroacetyl)amino]ethyl]-4-methylpyrazin-4-ium-2-carboxamide (PubChem CID 8991081) has the molecular formula C10H13Cl2N4O2+ and a molecular weight of 292.15 g/mol. Its IUPAC name is N-[2-[(2,2-dichloroacetyl)amino]ethyl]-4-methylpyrazin-4-ium-2-carboxamide.
| Compound Name | N-[2-[(2,2-dichloroacetyl)amino]ethyl]-4-methylpyrazin-4-ium-2-carboxamide |
|---|---|
| PubChem CID | 8991081 |
| Molecular Formula | C10H13Cl2N4O2+ |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | N-[2-[(2,2-dichloroacetyl)amino]ethyl]-4-methylpyrazin-4-ium-2-carboxamide |
| SMILES | C[n+]1ccnc(C(=O)NCCNC(=O)C(Cl)Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N4O2/c1-16-5-4-13-7(6-16)9(17)14-2-3-15-10(18)8(11)12/h4-6,8H,2-3H2,1H3,(H-,14,15,17,18)/p+1 |
| InChIKey | DOYSRVPMAVWWSW-UHFFFAOYSA-O |
| XLogP | -0.44 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|