C8H18N4O2 — CID 71347825
N'-[3-(3-aminopropylamino)propyl]oxamide (PubChem CID 71347825) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is N'-[3-(3-aminopropylamino)propyl]oxamide.
| Compound Name | N'-[3-(3-aminopropylamino)propyl]oxamide |
|---|---|
| PubChem CID | 71347825 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | N'-[3-(3-aminopropylamino)propyl]oxamide |
| SMILES | NCCCNCCCNC(=O)C(N)=O |
| InChI | InChI=1S/C8H18N4O2/c9-3-1-4-11-5-2-6-12-8(14)7(10)13/h11H,1-6,9H2,(H2,10,13)(H,12,14) |
| InChIKey | BKQLICJBPJJIAH-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|