About N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine
N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine (PubChem CID 145423239) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine |
| PubChem CID | 145423239 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine |
| SMILES | C=C(NCCCNCC)OC |
| InChI | InChI=1S/C8H18N2O/c1-4-9-6-5-7-10-8(2)11-3/h9-10H,2,4-7H2,1,3H3 |
| InChIKey | IKOMDOBVGZIILK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine?
The IUPAC name of N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine (CID 145423239) is N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine.
What is the SMILES notation for N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine?
The canonical SMILES for N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine is C=C(NCCCNCC)OC.
What is the InChIKey of N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine?
The InChIKey is IKOMDOBVGZIILK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-4-9-6-5-7-10-8(2)11-3/h9-10H,2,4-7H2,1,3H3.
What are the key properties of N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine?
N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine has a molecular weight of 158.25 g/mol, XLogP of 0.69, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine is sourced from PubChem (CID 145423239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).