C8H18N2O — CID 145423239
N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine (PubChem CID 145423239) has the molecular formula C8H18N2O and a molecular weight of 158.25 g/mol. Its IUPAC name is N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine.
| Compound Name | N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 145423239 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N-ethyl-N'-(1-methoxyethenyl)propane-1,3-diamine |
| SMILES | C=C(NCCCNCC)OC |
| InChI | InChI=1S/C8H18N2O/c1-4-9-6-5-7-10-8(2)11-3/h9-10H,2,4-7H2,1,3H3 |
| InChIKey | IKOMDOBVGZIILK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|