C10H14F2 — CID 123433916
4,5-difluoro-3-propan-2-ylhepta-1,3,5-triene (PubChem CID 123433916) has the molecular formula C10H14F2 and a molecular weight of 172.22 g/mol. Its IUPAC name is 4,5-difluoro-3-propan-2-ylhepta-1,3,5-triene.
| Compound Name | 4,5-difluoro-3-propan-2-ylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 123433916 |
| Molecular Formula | C10H14F2 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 4,5-difluoro-3-propan-2-ylhepta-1,3,5-triene |
| SMILES | C=CC(=C(F)C(F)=CC)C(C)C |
| InChI | InChI=1S/C10H14F2/c1-5-8(7(3)4)10(12)9(11)6-2/h5-7H,1H2,2-4H3 |
| InChIKey | IYEPTKWCLOVQAT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|