C14H22F4 — CID 177485167
(3Z)-7,7,8,8-tetrafluoro-3,4-di(propan-2-yl)octa-1,3-diene (PubChem CID 177485167) has the molecular formula C14H22F4 and a molecular weight of 266.32 g/mol. Its IUPAC name is (3Z)-7,7,8,8-tetrafluoro-3,4-di(propan-2-yl)octa-1,3-diene.
| Compound Name | (3Z)-7,7,8,8-tetrafluoro-3,4-di(propan-2-yl)octa-1,3-diene |
|---|---|
| PubChem CID | 177485167 |
| Molecular Formula | C14H22F4 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (3Z)-7,7,8,8-tetrafluoro-3,4-di(propan-2-yl)octa-1,3-diene |
| SMILES | C=C/C(=C(/CCC(F)(F)C(F)F)C(C)C)C(C)C |
| InChI | InChI=1S/C14H22F4/c1-6-11(9(2)3)12(10(4)5)7-8-14(17,18)13(15)16/h6,9-10,13H,1,7-8H2,2-5H3/b12-11+ |
| InChIKey | OUHSVAWCMITPPV-VAWYXSNFSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|