C13H22F4O — CID 149416341
(E)-8,8,9,9-tetrafluoro-5-methyl-1-propoxynon-4-ene (PubChem CID 149416341) has the molecular formula C13H22F4O and a molecular weight of 270.31 g/mol. Its IUPAC name is (E)-8,8,9,9-tetrafluoro-5-methyl-1-propoxynon-4-ene.
| Compound Name | (E)-8,8,9,9-tetrafluoro-5-methyl-1-propoxynon-4-ene |
|---|---|
| PubChem CID | 149416341 |
| Molecular Formula | C13H22F4O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (E)-8,8,9,9-tetrafluoro-5-methyl-1-propoxynon-4-ene |
| SMILES | CCCOCCC/C=C(\C)CCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H22F4O/c1-3-9-18-10-5-4-6-11(2)7-8-13(16,17)12(14)15/h6,12H,3-5,7-10H2,1-2H3/b11-6+ |
| InChIKey | YSGGXTNNVPYFLQ-IZZDOVSWSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|