C14H14F4O — CID 122371780
(E)-6,6,7,7-tetrafluoro-3-methyl-1-phenylhept-2-en-1-one (PubChem CID 122371780) has the molecular formula C14H14F4O and a molecular weight of 274.26 g/mol. Its IUPAC name is (E)-6,6,7,7-tetrafluoro-3-methyl-1-phenylhept-2-en-1-one.
| Compound Name | (E)-6,6,7,7-tetrafluoro-3-methyl-1-phenylhept-2-en-1-one |
|---|---|
| PubChem CID | 122371780 |
| Molecular Formula | C14H14F4O |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (E)-6,6,7,7-tetrafluoro-3-methyl-1-phenylhept-2-en-1-one |
| SMILES | C/C(=C\C(=O)c1ccccc1)CCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H14F4O/c1-10(7-8-14(17,18)13(15)16)9-12(19)11-5-3-2-4-6-11/h2-6,9,13H,7-8H2,1H3/b10-9+ |
| InChIKey | KORVMCQQHNKEGV-MDZDMXLPSA-N |
| XLogP | 4.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|