C10H9F3N2O — CID 177436392
(E)-4,4,4-trifluoro-3-hydrazinyl-1-phenylbut-2-en-1-one (PubChem CID 177436392) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-hydrazinyl-1-phenylbut-2-en-1-one.
| Compound Name | (E)-4,4,4-trifluoro-3-hydrazinyl-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 177436392 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-hydrazinyl-1-phenylbut-2-en-1-one |
| SMILES | NN/C(=C/C(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O/c11-10(12,13)9(15-14)6-8(16)7-4-2-1-3-5-7/h1-6,15H,14H2/b9-6+ |
| InChIKey | XPGFEEJEPNZJKD-RMKNXTFCSA-N |
| XLogP | 1.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|