C13H11F3O — CID 177493417
(E)-3-cyclopropyl-4,4,4-trifluoro-1-phenylbut-2-en-1-one (PubChem CID 177493417) has the molecular formula C13H11F3O and a molecular weight of 240.22 g/mol. Its IUPAC name is (E)-3-cyclopropyl-4,4,4-trifluoro-1-phenylbut-2-en-1-one.
| Compound Name | (E)-3-cyclopropyl-4,4,4-trifluoro-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 177493417 |
| Molecular Formula | C13H11F3O |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (E)-3-cyclopropyl-4,4,4-trifluoro-1-phenylbut-2-en-1-one |
| SMILES | O=C(/C=C(\C1CC1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H11F3O/c14-13(15,16)11(9-6-7-9)8-12(17)10-4-2-1-3-5-10/h1-5,8-9H,6-7H2/b11-8+ |
| InChIKey | OULDKPGXXRMVNO-DHZHZOJOSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|