C18H11F9GeO2 — CID 102041821
(E)-1,3-diphenyl-3-[tris(trifluoromethyl)germyloxy]prop-2-en-1-one (PubChem CID 102041821) has the molecular formula C18H11F9GeO2 and a molecular weight of 502.88 g/mol. Its IUPAC name is (E)-1,3-diphenyl-3-[tris(trifluoromethyl)germyloxy]prop-2-en-1-one.
| Compound Name | (E)-1,3-diphenyl-3-[tris(trifluoromethyl)germyloxy]prop-2-en-1-one |
|---|---|
| PubChem CID | 102041821 |
| Molecular Formula | C18H11F9GeO2 |
| Molecular Weight | 502.88 g/mol |
| Exact Mass | 503.98 |
| IUPAC Name | (E)-1,3-diphenyl-3-[tris(trifluoromethyl)germyloxy]prop-2-en-1-one |
| SMILES | O=C(/C=C(/O[Ge](C(F)(F)F)(C(F)(F)F)C(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H11F9GeO2/c19-16(20,21)28(17(22,23)24,18(25,26)27)30-15(13-9-5-2-6-10-13)11-14(29)12-7-3-1-4-8-12/h1-11H/b15-11+ |
| InChIKey | PKZMSJHWTVKLMU-RVDMUPIBSA-N |
| XLogP | 6.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.88 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|