C19H12F7NO2 — CID 628724
2,2,3,3,4,4,4-heptafluoro-N-(3-oxo-1,3-diphenylprop-1-enyl)butanamide (PubChem CID 628724) has the molecular formula C19H12F7NO2 and a molecular weight of 419.30 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(3-oxo-1,3-diphenylprop-1-enyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(3-oxo-1,3-diphenylprop-1-enyl)butanamide |
|---|---|
| PubChem CID | 628724 |
| Molecular Formula | C19H12F7NO2 |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(3-oxo-1,3-diphenylprop-1-enyl)butanamide |
| SMILES | O=C(C=C(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H12F7NO2/c20-17(21,18(22,23)19(24,25)26)16(29)27-14(12-7-3-1-4-8-12)11-15(28)13-9-5-2-6-10-13/h1-11H,(H,27,29) |
| InChIKey | NBGFVSRTDVICTE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|