C26H19NO2 — CID 5377898
N-[(E)-3-oxo-1,3-diphenylprop-1-enyl]naphthalene-2-carboxamide (PubChem CID 5377898) has the molecular formula C26H19NO2 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[(E)-3-oxo-1,3-diphenylprop-1-enyl]naphthalene-2-carboxamide.
| Compound Name | N-[(E)-3-oxo-1,3-diphenylprop-1-enyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5377898 |
| Molecular Formula | C26H19NO2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[(E)-3-oxo-1,3-diphenylprop-1-enyl]naphthalene-2-carboxamide |
| SMILES | O=C(/C=C(/NC(=O)c1ccc2ccccc2c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H19NO2/c28-25(21-12-5-2-6-13-21)18-24(20-10-3-1-4-11-20)27-26(29)23-16-15-19-9-7-8-14-22(19)17-23/h1-18H,(H,27,29)/b24-18+ |
| InChIKey | KUTSUHIQGNMYAV-HKOYGPOVSA-N |
| XLogP | 5.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|