C27H21NO2 — CID 177400988
(E)-3-[(E)-1-naphthalen-2-ylethylideneamino]oxy-1,3-diphenylprop-2-en-1-one (PubChem CID 177400988) has the molecular formula C27H21NO2 and a molecular weight of 391.47 g/mol. Its IUPAC name is (E)-3-[(E)-1-naphthalen-2-ylethylideneamino]oxy-1,3-diphenylprop-2-en-1-one.
| Compound Name | (E)-3-[(E)-1-naphthalen-2-ylethylideneamino]oxy-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 177400988 |
| Molecular Formula | C27H21NO2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (E)-3-[(E)-1-naphthalen-2-ylethylideneamino]oxy-1,3-diphenylprop-2-en-1-one |
| SMILES | C/C(=N\O/C(=C/C(=O)c1ccccc1)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H21NO2/c1-20(24-17-16-21-10-8-9-15-25(21)18-24)28-30-27(23-13-6-3-7-14-23)19-26(29)22-11-4-2-5-12-22/h2-19H,1H3/b27-19+,28-20+ |
| InChIKey | IMHJVJTYMXWUBR-MKYUKRCKSA-N |
| XLogP | 6.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|