C21H16O2 — CID 13085906
(Z)-3-phenoxy-1,3-diphenylprop-2-en-1-one (PubChem CID 13085906) has the molecular formula C21H16O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (Z)-3-phenoxy-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-3-phenoxy-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 13085906 |
| Molecular Formula | C21H16O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (Z)-3-phenoxy-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C=C(\Oc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16O2/c22-20(17-10-4-1-5-11-17)16-21(18-12-6-2-7-13-18)23-19-14-8-3-9-15-19/h1-16H/b21-16- |
| InChIKey | HAKUEQCXTHCYOP-PGMHBOJBSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|