C22H18OTi — CID 87497122
1,4-diphenylbuta-1,3-dienoxybenzene;titanium (PubChem CID 87497122) has the molecular formula C22H18OTi and a molecular weight of 346.25 g/mol. Its IUPAC name is 1,4-diphenylbuta-1,3-dienoxybenzene;titanium.
| Compound Name | 1,4-diphenylbuta-1,3-dienoxybenzene;titanium |
|---|---|
| PubChem CID | 87497122 |
| Molecular Formula | C22H18OTi |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1,4-diphenylbuta-1,3-dienoxybenzene;titanium |
| SMILES | C(=Cc1ccccc1)C=C(Oc1ccccc1)c1ccccc1.[Ti] |
| InChI | InChI=1S/C22H18O.Ti/c1-4-11-19(12-5-1)13-10-18-22(20-14-6-2-7-15-20)23-21-16-8-3-9-17-21;/h1-18H; |
| InChIKey | QOPNMMMOTOYRSN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|