About 1,4-diphenylbuta-1,3-dienoxybenzene;titanium
1,4-diphenylbuta-1,3-dienoxybenzene;titanium (PubChem CID 87497122) has the molecular formula C22H18OTi
and a molecular weight of 346.25 g/mol. Its IUPAC name is 1,4-diphenylbuta-1,3-dienoxybenzene;titanium.
Molecular Properties
| Compound Name | 1,4-diphenylbuta-1,3-dienoxybenzene;titanium |
| PubChem CID | 87497122 |
| Molecular Formula | C22H18OTi |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1,4-diphenylbuta-1,3-dienoxybenzene;titanium |
| SMILES | C(=Cc1ccccc1)C=C(Oc1ccccc1)c1ccccc1.[Ti] |
| InChI | InChI=1S/C22H18O.Ti/c1-4-11-19(12-5-1)13-10-18-22(20-14-6-2-7-15-20)23-21-16-8-3-9-17-21;/h1-18H; |
| InChIKey | QOPNMMMOTOYRSN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diphenylbuta-1,3-dienoxybenzene;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diphenylbuta-1,3-dienoxybenzene;titanium?
The IUPAC name of 1,4-diphenylbuta-1,3-dienoxybenzene;titanium (CID 87497122) is 1,4-diphenylbuta-1,3-dienoxybenzene;titanium.
What is the SMILES notation for 1,4-diphenylbuta-1,3-dienoxybenzene;titanium?
The canonical SMILES for 1,4-diphenylbuta-1,3-dienoxybenzene;titanium is C(=Cc1ccccc1)C=C(Oc1ccccc1)c1ccccc1.[Ti].
What is the InChIKey of 1,4-diphenylbuta-1,3-dienoxybenzene;titanium?
The InChIKey is QOPNMMMOTOYRSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18O.Ti/c1-4-11-19(12-5-1)13-10-18-22(20-14-6-2-7-15-20)23-21-16-8-3-9-17-21;/h1-18H;.
What are the key properties of 1,4-diphenylbuta-1,3-dienoxybenzene;titanium?
1,4-diphenylbuta-1,3-dienoxybenzene;titanium has a molecular weight of 346.25 g/mol, XLogP of 5.82, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diphenylbuta-1,3-dienoxybenzene;titanium is sourced from PubChem (CID 87497122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).