C20H22O — CID 90913634
(1-butoxy-4-phenylbuta-1,3-dienyl)benzene (PubChem CID 90913634) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is (1-butoxy-4-phenylbuta-1,3-dienyl)benzene.
| Compound Name | (1-butoxy-4-phenylbuta-1,3-dienyl)benzene |
|---|---|
| PubChem CID | 90913634 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (1-butoxy-4-phenylbuta-1,3-dienyl)benzene |
| SMILES | CCCCOC(=CC=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22O/c1-2-3-17-21-20(19-14-8-5-9-15-19)16-10-13-18-11-6-4-7-12-18/h4-16H,2-3,17H2,1H3 |
| InChIKey | NKNPRNPYWLXOPK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|