C14H9EuF3O2 — CID 158715426
europium;4,4,4-trifluoro-3-hydroxy-1-naphthalen-2-ylbut-2-en-1-one (PubChem CID 158715426) has the molecular formula C14H9EuF3O2 and a molecular weight of 418.18 g/mol. Its IUPAC name is europium;4,4,4-trifluoro-3-hydroxy-1-naphthalen-2-ylbut-2-en-1-one.
| Compound Name | europium;4,4,4-trifluoro-3-hydroxy-1-naphthalen-2-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 158715426 |
| Molecular Formula | C14H9EuF3O2 |
| Molecular Weight | 418.18 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | europium;4,4,4-trifluoro-3-hydroxy-1-naphthalen-2-ylbut-2-en-1-one |
| SMILES | O=C(C=C(O)C(F)(F)F)c1ccc2ccccc2c1.[Eu] |
| InChI | InChI=1S/C14H9F3O2.Eu/c15-14(16,17)13(19)8-12(18)11-6-5-9-3-1-2-4-10(9)7-11;/h1-8,19H; |
| InChIKey | TZTACFWQEYKGEB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.18 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|