C23H18F3NO5S — CID 4540181
(1,1,1-trifluoro-4-naphthalen-2-yl-4-oxobut-2-en-2-yl) 4-(dimethylsulfamoyl)benzoate (PubChem CID 4540181) has the molecular formula C23H18F3NO5S and a molecular weight of 477.46 g/mol. Its IUPAC name is (1,1,1-trifluoro-4-naphthalen-2-yl-4-oxobut-2-en-2-yl) 4-(dimethylsulfamoyl)benzoate.
| Compound Name | (1,1,1-trifluoro-4-naphthalen-2-yl-4-oxobut-2-en-2-yl) 4-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 4540181 |
| Molecular Formula | C23H18F3NO5S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (1,1,1-trifluoro-4-naphthalen-2-yl-4-oxobut-2-en-2-yl) 4-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)OC(=CC(=O)c2ccc3ccccc3c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H18F3NO5S/c1-27(2)33(30,31)19-11-9-16(10-12-19)22(29)32-21(23(24,25)26)14-20(28)18-8-7-15-5-3-4-6-17(15)13-18/h3-14H,1-2H3 |
| InChIKey | OFULCDIGKDARBE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|