C19H15F3N2O3S — CID 55878446
2,2,2-trifluoro-N-[4-[methyl(naphthalen-2-yl)sulfamoyl]phenyl]acetamide (PubChem CID 55878446) has the molecular formula C19H15F3N2O3S and a molecular weight of 408.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-[methyl(naphthalen-2-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-[methyl(naphthalen-2-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 55878446 |
| Molecular Formula | C19H15F3N2O3S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-[methyl(naphthalen-2-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CN(c1ccc2ccccc2c1)S(=O)(=O)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N2O3S/c1-24(16-9-6-13-4-2-3-5-14(13)12-16)28(26,27)17-10-7-15(8-11-17)23-18(25)19(20,21)22/h2-12H,1H3,(H,23,25) |
| InChIKey | JGJPGNHRZPJUST-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |